C19H31N2O4+ — CID 8680151
2-(azocan-1-ium-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide (PubChem CID 8680151) has the molecular formula C19H31N2O4+ and a molecular weight of 351.47 g/mol. Its IUPAC name is 2-(azocan-1-ium-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(azocan-1-ium-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 8680151 |
| Molecular Formula | C19H31N2O4+ |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 2-(azocan-1-ium-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
| SMILES | COc1cc(CNC(=O)C[NH+]2CCCCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C19H30N2O4/c1-23-16-11-15(12-17(24-2)19(16)25-3)13-20-18(22)14-21-9-7-5-4-6-8-10-21/h11-12H,4-10,13-14H2,1-3H3,(H,20,22)/p+1 |
| InChIKey | JNPUHFJFYMBXFI-UHFFFAOYSA-O |
| XLogP | 1.18 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |