C17H25N2O3+ — CID 8896036
methyl 4-[[[2-(azepan-1-ium-1-yl)acetyl]amino]methyl]benzoate (PubChem CID 8896036) has the molecular formula C17H25N2O3+ and a molecular weight of 305.40 g/mol. Its IUPAC name is methyl 4-[[[2-(azepan-1-ium-1-yl)acetyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[2-(azepan-1-ium-1-yl)acetyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 8896036 |
| Molecular Formula | C17H25N2O3+ |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | methyl 4-[[[2-(azepan-1-ium-1-yl)acetyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)C[NH+]2CCCCCC2)cc1 |
| InChI | InChI=1S/C17H24N2O3/c1-22-17(21)15-8-6-14(7-9-15)12-18-16(20)13-19-10-4-2-3-5-11-19/h6-9H,2-5,10-13H2,1H3,(H,18,20)/p+1 |
| InChIKey | VEXAMTARXWSDTR-UHFFFAOYSA-O |
| XLogP | 0.55 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |