C11H16N2O2 — CID 83006457
methyl 4-[(2,2-dimethylhydrazinyl)methyl]benzoate (PubChem CID 83006457) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is methyl 4-[(2,2-dimethylhydrazinyl)methyl]benzoate.
| Compound Name | methyl 4-[(2,2-dimethylhydrazinyl)methyl]benzoate |
|---|---|
| PubChem CID | 83006457 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | methyl 4-[(2,2-dimethylhydrazinyl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNN(C)C)cc1 |
| InChI | InChI=1S/C11H16N2O2/c1-13(2)12-8-9-4-6-10(7-5-9)11(14)15-3/h4-7,12H,8H2,1-3H3 |
| InChIKey | AZLQEDBIRHYVGJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|