C16H23N3O4 — CID 8712059
methyl 4-[[[2-[[2-(dimethylamino)-2-oxoethyl]-methylamino]acetyl]amino]methyl]benzoate (PubChem CID 8712059) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is methyl 4-[[[2-[[2-(dimethylamino)-2-oxoethyl]-methylamino]acetyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[2-[[2-(dimethylamino)-2-oxoethyl]-methylamino]acetyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 8712059 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | methyl 4-[[[2-[[2-(dimethylamino)-2-oxoethyl]-methylamino]acetyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)CN(C)CC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C16H23N3O4/c1-18(2)15(21)11-19(3)10-14(20)17-9-12-5-7-13(8-6-12)16(22)23-4/h5-8H,9-11H2,1-4H3,(H,17,20) |
| InChIKey | ZYWLIUWVIFHFTJ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |