C22H26FN2O3+ — CID 7435772
N-[(4-fluorophenyl)methyl]-2-[4-(4-methoxybenzoyl)piperidin-1-ium-1-yl]acetamide (PubChem CID 7435772) has the molecular formula C22H26FN2O3+ and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[4-(4-methoxybenzoyl)piperidin-1-ium-1-yl]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[4-(4-methoxybenzoyl)piperidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 7435772 |
| Molecular Formula | C22H26FN2O3+ |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[4-(4-methoxybenzoyl)piperidin-1-ium-1-yl]acetamide |
| SMILES | COc1ccc(C(=O)C2CC[NH+](CC(=O)NCc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H25FN2O3/c1-28-20-8-4-17(5-9-20)22(27)18-10-12-25(13-11-18)15-21(26)24-14-16-2-6-19(23)7-3-16/h2-9,18H,10-15H2,1H3,(H,24,26)/p+1 |
| InChIKey | VUYZECFNBPGWMZ-UHFFFAOYSA-O |
| XLogP | 1.63 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |