C15H21N2O4+ — CID 8903924
methyl 4-[[(2-morpholin-4-ium-4-ylacetyl)amino]methyl]benzoate (PubChem CID 8903924) has the molecular formula C15H21N2O4+ and a molecular weight of 293.34 g/mol. Its IUPAC name is methyl 4-[[(2-morpholin-4-ium-4-ylacetyl)amino]methyl]benzoate.
| Compound Name | methyl 4-[[(2-morpholin-4-ium-4-ylacetyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 8903924 |
| Molecular Formula | C15H21N2O4+ |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | methyl 4-[[(2-morpholin-4-ium-4-ylacetyl)amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)C[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C15H20N2O4/c1-20-15(19)13-4-2-12(3-5-13)10-16-14(18)11-17-6-8-21-9-7-17/h2-5H,6-11H2,1H3,(H,16,18)/p+1 |
| InChIKey | PLJSLUDNMLBWDI-UHFFFAOYSA-O |
| XLogP | -1.00 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |