C14H20N3O3+ — CID 2697515
N-(benzylcarbamoyl)-2-morpholin-4-ium-4-ylacetamide (PubChem CID 2697515) has the molecular formula C14H20N3O3+ and a molecular weight of 278.33 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-2-morpholin-4-ium-4-ylacetamide.
| Compound Name | N-(benzylcarbamoyl)-2-morpholin-4-ium-4-ylacetamide |
|---|---|
| PubChem CID | 2697515 |
| Molecular Formula | C14H20N3O3+ |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N-(benzylcarbamoyl)-2-morpholin-4-ium-4-ylacetamide |
| SMILES | O=C(C[NH+]1CCOCC1)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C14H19N3O3/c18-13(11-17-6-8-20-9-7-17)16-14(19)15-10-12-4-2-1-3-5-12/h1-5H,6-11H2,(H2,15,16,18,19)/p+1 |
| InChIKey | BBYWGJJXRVMJFT-UHFFFAOYSA-O |
| XLogP | -1.07 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |