C11H16NO4+ — CID 5077998
methyl 5-(morpholin-4-ium-4-ylmethyl)furan-2-carboxylate (PubChem CID 5077998) has the molecular formula C11H16NO4+ and a molecular weight of 226.25 g/mol. Its IUPAC name is methyl 5-(morpholin-4-ium-4-ylmethyl)furan-2-carboxylate.
| Compound Name | methyl 5-(morpholin-4-ium-4-ylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 5077998 |
| Molecular Formula | C11H16NO4+ |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | methyl 5-(morpholin-4-ium-4-ylmethyl)furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C[NH+]2CCOCC2)o1 |
| InChI | InChI=1S/C11H15NO4/c1-14-11(13)10-3-2-9(16-10)8-12-4-6-15-7-5-12/h2-3H,4-8H2,1H3/p+1 |
| InChIKey | LRTOUUMXSRHMDH-UHFFFAOYSA-O |
| XLogP | -0.52 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |