C17H20FN2O5S+ — CID 8749181
methyl 5-[[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]furan-2-carboxylate (PubChem CID 8749181) has the molecular formula C17H20FN2O5S+ and a molecular weight of 383.42 g/mol. Its IUPAC name is methyl 5-[[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 8749181 |
| Molecular Formula | C17H20FN2O5S+ |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | methyl 5-[[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C[NH+]2CCN(S(=O)(=O)c3ccccc3F)CC2)o1 |
| InChI | InChI=1S/C17H19FN2O5S/c1-24-17(21)15-7-6-13(25-15)12-19-8-10-20(11-9-19)26(22,23)16-5-3-2-4-14(16)18/h2-7H,8-12H2,1H3/p+1 |
| InChIKey | HYAOSAPJAUHBNG-UHFFFAOYSA-O |
| XLogP | 0.29 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |