C14H18FN3O5S — CID 8749312
methyl N-[2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]acetyl]carbamate (PubChem CID 8749312) has the molecular formula C14H18FN3O5S and a molecular weight of 359.38 g/mol. Its IUPAC name is methyl N-[2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]acetyl]carbamate.
| Compound Name | methyl N-[2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]acetyl]carbamate |
|---|---|
| PubChem CID | 8749312 |
| Molecular Formula | C14H18FN3O5S |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | methyl N-[2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]acetyl]carbamate |
| SMILES | COC(=O)NC(=O)CN1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C14H18FN3O5S/c1-23-14(20)16-13(19)10-17-6-8-18(9-7-17)24(21,22)12-5-3-2-4-11(12)15/h2-5H,6-10H2,1H3,(H,16,19,20) |
| InChIKey | PMDBXQQEZQKCRU-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |