C19H20ClFN4O4S — CID 5121585
4-chloro-N'-[2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]acetyl]benzohydrazide (PubChem CID 5121585) has the molecular formula C19H20ClFN4O4S and a molecular weight of 454.91 g/mol. Its IUPAC name is 4-chloro-N'-[2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]acetyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 5121585 |
| Molecular Formula | C19H20ClFN4O4S |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 4-chloro-N'-[2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]acetyl]benzohydrazide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2ccccc2F)CC1)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClFN4O4S/c20-15-7-5-14(6-8-15)19(27)23-22-18(26)13-24-9-11-25(12-10-24)30(28,29)17-4-2-1-3-16(17)21/h1-8H,9-13H2,(H,22,26)(H,23,27) |
| InChIKey | XWBKTFGUXSVDPV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|