C19H24FN2O3S+ — CID 2442648
2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-4,5-dimethylphenol (PubChem CID 2442648) has the molecular formula C19H24FN2O3S+ and a molecular weight of 379.48 g/mol. Its IUPAC name is 2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-4,5-dimethylphenol.
| Compound Name | 2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-4,5-dimethylphenol |
|---|---|
| PubChem CID | 2442648 |
| Molecular Formula | C19H24FN2O3S+ |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-4,5-dimethylphenol |
| SMILES | Cc1cc(O)c(C[NH+]2CCN(S(=O)(=O)c3ccccc3F)CC2)cc1C |
| InChI | InChI=1S/C19H23FN2O3S/c1-14-11-16(18(23)12-15(14)2)13-21-7-9-22(10-8-21)26(24,25)19-6-4-3-5-17(19)20/h3-6,11-12,23H,7-10,13H2,1-2H3/p+1 |
| InChIKey | XCOZXCLOBXBKNE-UHFFFAOYSA-O |
| XLogP | 1.24 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|