C25H37N2O3S+ — CID 2502899
5-methyl-4-propan-2-yl-2-[[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]phenol (PubChem CID 2502899) has the molecular formula C25H37N2O3S+ and a molecular weight of 445.65 g/mol. Its IUPAC name is 5-methyl-4-propan-2-yl-2-[[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]phenol.
| Compound Name | 5-methyl-4-propan-2-yl-2-[[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 2502899 |
| Molecular Formula | C25H37N2O3S+ |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 5-methyl-4-propan-2-yl-2-[[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]phenol |
| SMILES | Cc1cc(O)c(C[NH+]2CCN(S(=O)(=O)c3c(C)c(C)cc(C)c3C)CC2)cc1C(C)C |
| InChI | InChI=1S/C25H36N2O3S/c1-16(2)23-14-22(24(28)13-19(23)5)15-26-8-10-27(11-9-26)31(29,30)25-20(6)17(3)12-18(4)21(25)7/h12-14,16,28H,8-11,15H2,1-7H3/p+1 |
| InChIKey | POOFMWBDZOKBGQ-UHFFFAOYSA-O |
| XLogP | 3.15 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|