C21H27FN2O3S — CID 2663725
2-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-5-methyl-4-propan-2-ylphenol (PubChem CID 2663725) has the molecular formula C21H27FN2O3S and a molecular weight of 406.52 g/mol. Its IUPAC name is 2-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-5-methyl-4-propan-2-ylphenol.
| Compound Name | 2-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-5-methyl-4-propan-2-ylphenol |
|---|---|
| PubChem CID | 2663725 |
| Molecular Formula | C21H27FN2O3S |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-5-methyl-4-propan-2-ylphenol |
| SMILES | Cc1cc(O)c(CN2CCN(S(=O)(=O)c3cccc(F)c3)CC2)cc1C(C)C |
| InChI | InChI=1S/C21H27FN2O3S/c1-15(2)20-12-17(21(25)11-16(20)3)14-23-7-9-24(10-8-23)28(26,27)19-6-4-5-18(22)13-19/h4-6,11-13,15,25H,7-10,14H2,1-3H3 |
| InChIKey | BBQODHVGXGCLLE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|