C18H22ClFN2O2S — CID 163331829
1-(3-fluorophenyl)sulfonyl-4-[(4-methylphenyl)methyl]piperazine;hydrochloride (PubChem CID 163331829) has the molecular formula C18H22ClFN2O2S and a molecular weight of 384.90 g/mol. Its IUPAC name is 1-(3-fluorophenyl)sulfonyl-4-[(4-methylphenyl)methyl]piperazine;hydrochloride.
| Compound Name | 1-(3-fluorophenyl)sulfonyl-4-[(4-methylphenyl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 163331829 |
| Molecular Formula | C18H22ClFN2O2S |
| Molecular Weight | 384.90 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 1-(3-fluorophenyl)sulfonyl-4-[(4-methylphenyl)methyl]piperazine;hydrochloride |
| SMILES | Cc1ccc(CN2CCN(S(=O)(=O)c3cccc(F)c3)CC2)cc1.Cl |
| InChI | InChI=1S/C18H21FN2O2S.ClH/c1-15-5-7-16(8-6-15)14-20-9-11-21(12-10-20)24(22,23)18-4-2-3-17(19)13-18;/h2-8,13H,9-12,14H2,1H3;1H |
| InChIKey | OQMPQPFJVAMELE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.90 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |