C16H25NO3S — CID 81097436
4-methyl-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidin-4-ol (PubChem CID 81097436) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 4-methyl-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidin-4-ol.
| Compound Name | 4-methyl-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidin-4-ol |
|---|---|
| PubChem CID | 81097436 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 4-methyl-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidin-4-ol |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCC(C)(O)CC2)c1C |
| InChI | InChI=1S/C16H25NO3S/c1-11-10-12(2)14(4)15(13(11)3)21(19,20)17-8-6-16(5,18)7-9-17/h10,18H,6-9H2,1-5H3 |
| InChIKey | OCFSCMABZFWRCH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |