C15H24N2O3S — CID 107403545
1-(2-amino-3,6-dimethylphenyl)sulfonyl-4-methylazepan-4-ol (PubChem CID 107403545) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-(2-amino-3,6-dimethylphenyl)sulfonyl-4-methylazepan-4-ol.
| Compound Name | 1-(2-amino-3,6-dimethylphenyl)sulfonyl-4-methylazepan-4-ol |
|---|---|
| PubChem CID | 107403545 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 1-(2-amino-3,6-dimethylphenyl)sulfonyl-4-methylazepan-4-ol |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCCC(C)(O)CC2)c1N |
| InChI | InChI=1S/C15H24N2O3S/c1-11-5-6-12(2)14(13(11)16)21(19,20)17-9-4-7-15(3,18)8-10-17/h5-6,18H,4,7-10,16H2,1-3H3 |
| InChIKey | XPHFSWZTTRVLTB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|