C15H25N3O2S — CID 103171174
1-(2-amino-3,6-dimethylphenyl)sulfonyl-N,N-dimethylpiperidin-4-amine (PubChem CID 103171174) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is 1-(2-amino-3,6-dimethylphenyl)sulfonyl-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-(2-amino-3,6-dimethylphenyl)sulfonyl-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 103171174 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 1-(2-amino-3,6-dimethylphenyl)sulfonyl-N,N-dimethylpiperidin-4-amine |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCC(N(C)C)CC2)c1N |
| InChI | InChI=1S/C15H25N3O2S/c1-11-5-6-12(2)15(14(11)16)21(19,20)18-9-7-13(8-10-18)17(3)4/h5-6,13H,7-10,16H2,1-4H3 |
| InChIKey | CJRZPHDGIXYOJN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|