C14H21NO3S — CID 81103770
1-(3,4-dimethylphenyl)sulfonyl-4-methylpiperidin-4-ol (PubChem CID 81103770) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)sulfonyl-4-methylpiperidin-4-ol.
| Compound Name | 1-(3,4-dimethylphenyl)sulfonyl-4-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 81103770 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-(3,4-dimethylphenyl)sulfonyl-4-methylpiperidin-4-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C)(O)CC2)cc1C |
| InChI | InChI=1S/C14H21NO3S/c1-11-4-5-13(10-12(11)2)19(17,18)15-8-6-14(3,16)7-9-15/h4-5,10,16H,6-9H2,1-3H3 |
| InChIKey | OSZTZNWPDUJAAR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |