C16H26N2O2S — CID 113074853
1-tert-butyl-4-(3,4-dimethylphenyl)sulfonylpiperazine (PubChem CID 113074853) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is 1-tert-butyl-4-(3,4-dimethylphenyl)sulfonylpiperazine.
| Compound Name | 1-tert-butyl-4-(3,4-dimethylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 113074853 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-tert-butyl-4-(3,4-dimethylphenyl)sulfonylpiperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(C)(C)C)CC2)cc1C |
| InChI | InChI=1S/C16H26N2O2S/c1-13-6-7-15(12-14(13)2)21(19,20)18-10-8-17(9-11-18)16(3,4)5/h6-7,12H,8-11H2,1-5H3 |
| InChIKey | XCPKYEBAYDDEKK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |