C22H29N2O3S+ — CID 7911223
6-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2,3-dihydro-1H-inden-5-ol (PubChem CID 7911223) has the molecular formula C22H29N2O3S+ and a molecular weight of 401.55 g/mol. Its IUPAC name is 6-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 6-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 7911223 |
| Molecular Formula | C22H29N2O3S+ |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 6-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2,3-dihydro-1H-inden-5-ol |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CC[NH+](Cc3cc4c(cc3O)CCC4)CC2)c1 |
| InChI | InChI=1S/C22H28N2O3S/c1-16-6-7-17(2)22(12-16)28(26,27)24-10-8-23(9-11-24)15-20-13-18-4-3-5-19(18)14-21(20)25/h6-7,12-14,25H,3-5,8-11,15H2,1-2H3/p+1 |
| InChIKey | VRMXTFLNHKVDGL-UHFFFAOYSA-O |
| XLogP | 1.59 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|