C13H19FN3O3S+ — CID 8749217
(2R)-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide (PubChem CID 8749217) has the molecular formula C13H19FN3O3S+ and a molecular weight of 316.38 g/mol. Its IUPAC name is (2R)-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 8749217 |
| Molecular Formula | C13H19FN3O3S+ |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2R)-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide |
| SMILES | C[C@H](C(N)=O)[NH+]1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C13H18FN3O3S/c1-10(13(15)18)16-6-8-17(9-7-16)21(19,20)12-5-3-2-4-11(12)14/h2-5,10H,6-9H2,1H3,(H2,15,18)/p+1/t10-/m1/s1 |
| InChIKey | PVBHCMVDGWZJSV-SNVBAGLBSA-O |
| XLogP | -1.41 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |