C13H18Cl2N3O3S+ — CID 8748349
(2R)-2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide (PubChem CID 8748349) has the molecular formula C13H18Cl2N3O3S+ and a molecular weight of 367.28 g/mol. Its IUPAC name is (2R)-2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 8748349 |
| Molecular Formula | C13H18Cl2N3O3S+ |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | (2R)-2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide |
| SMILES | C[C@H](C(N)=O)[NH+]1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C13H17Cl2N3O3S/c1-9(13(16)19)17-4-6-18(7-5-17)22(20,21)12-8-10(14)2-3-11(12)15/h2-3,8-9H,4-7H2,1H3,(H2,16,19)/p+1/t9-/m1/s1 |
| InChIKey | PMZYQWNDRZRIGK-SECBINFHSA-O |
| XLogP | -0.24 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |