C21H27FN3O3S+ — CID 8690036
(2S)-N-ethyl-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-phenylpropanamide (PubChem CID 8690036) has the molecular formula C21H27FN3O3S+ and a molecular weight of 420.53 g/mol. Its IUPAC name is (2S)-N-ethyl-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-phenylpropanamide.
| Compound Name | (2S)-N-ethyl-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 8690036 |
| Molecular Formula | C21H27FN3O3S+ |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (2S)-N-ethyl-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-phenylpropanamide |
| SMILES | CCN(C(=O)[C@H](C)[NH+]1CCN(S(=O)(=O)c2ccccc2F)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H26FN3O3S/c1-3-25(18-9-5-4-6-10-18)21(26)17(2)23-13-15-24(16-14-23)29(27,28)20-12-8-7-11-19(20)22/h4-12,17H,3,13-16H2,1-2H3/p+1/t17-/m0/s1 |
| InChIKey | WTZHUZGFDRYFDN-KRWDZBQOSA-O |
| XLogP | 1.16 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |