C15H22N2O4 — CID 78912271
2-(prop-2-enylamino)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide (PubChem CID 78912271) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-(prop-2-enylamino)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(prop-2-enylamino)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 78912271 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-(prop-2-enylamino)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
| SMILES | C=CCNCC(=O)NCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O4/c1-5-6-16-10-14(18)17-9-11-7-12(19-2)15(21-4)13(8-11)20-3/h5,7-8,16H,1,6,9-10H2,2-4H3,(H,17,18) |
| InChIKey | DMHYOKMRHBQBQY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|