C20H25NO6 — CID 9483239
2-(3,4-dimethoxyphenyl)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide (PubChem CID 9483239) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 9483239 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CC(=O)NCc2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C20H25NO6/c1-23-15-7-6-13(8-16(15)24-2)11-19(22)21-12-14-9-17(25-3)20(27-5)18(10-14)26-4/h6-10H,11-12H2,1-5H3,(H,21,22) |
| InChIKey | MGMBEGKYBOISLA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |