C10H14N2OS — CID 79279865
2-(prop-2-enylamino)-N-(thiophen-3-ylmethyl)acetamide (PubChem CID 79279865) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-(prop-2-enylamino)-N-(thiophen-3-ylmethyl)acetamide.
| Compound Name | 2-(prop-2-enylamino)-N-(thiophen-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 79279865 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 2-(prop-2-enylamino)-N-(thiophen-3-ylmethyl)acetamide |
| SMILES | C=CCNCC(=O)NCc1ccsc1 |
| InChI | InChI=1S/C10H14N2OS/c1-2-4-11-7-10(13)12-6-9-3-5-14-8-9/h2-3,5,8,11H,1,4,6-7H2,(H,12,13) |
| InChIKey | QWOGLPQGFLEYOX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|