C10H14N4O — CID 106896069
2-(prop-2-enylamino)-N-(pyridazin-3-ylmethyl)acetamide (PubChem CID 106896069) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-(prop-2-enylamino)-N-(pyridazin-3-ylmethyl)acetamide.
| Compound Name | 2-(prop-2-enylamino)-N-(pyridazin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 106896069 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-(prop-2-enylamino)-N-(pyridazin-3-ylmethyl)acetamide |
| SMILES | C=CCNCC(=O)NCc1cccnn1 |
| InChI | InChI=1S/C10H14N4O/c1-2-5-11-8-10(15)12-7-9-4-3-6-13-14-9/h2-4,6,11H,1,5,7-8H2,(H,12,15) |
| InChIKey | ASXVUUGNTHLUBV-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|