C9H11NOS — CID 59609658
2-methyl-N-(thiophen-3-ylmethyl)prop-2-enamide (PubChem CID 59609658) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is 2-methyl-N-(thiophen-3-ylmethyl)prop-2-enamide.
| Compound Name | 2-methyl-N-(thiophen-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 59609658 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 2-methyl-N-(thiophen-3-ylmethyl)prop-2-enamide |
| SMILES | C=C(C)C(=O)NCc1ccsc1 |
| InChI | InChI=1S/C9H11NOS/c1-7(2)9(11)10-5-8-3-4-12-6-8/h3-4,6H,1,5H2,2H3,(H,10,11) |
| InChIKey | CQZWKIQDWIJKQO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|