C10H10N2O2S — CID 71806156
5-methyl-N-(thiophen-3-ylmethyl)-1,2-oxazole-4-carboxamide (PubChem CID 71806156) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is 5-methyl-N-(thiophen-3-ylmethyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 5-methyl-N-(thiophen-3-ylmethyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 71806156 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 5-methyl-N-(thiophen-3-ylmethyl)-1,2-oxazole-4-carboxamide |
| SMILES | Cc1oncc1C(=O)NCc1ccsc1 |
| InChI | InChI=1S/C10H10N2O2S/c1-7-9(5-12-14-7)10(13)11-4-8-2-3-15-6-8/h2-3,5-6H,4H2,1H3,(H,11,13) |
| InChIKey | HAYCAFPGXTUYCJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |