C12H11NO3S — CID 103892000
2,5-dihydroxy-N-(thiophen-3-ylmethyl)benzamide (PubChem CID 103892000) has the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. Its IUPAC name is 2,5-dihydroxy-N-(thiophen-3-ylmethyl)benzamide.
| Compound Name | 2,5-dihydroxy-N-(thiophen-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 103892000 |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 2,5-dihydroxy-N-(thiophen-3-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccsc1)c1cc(O)ccc1O |
| InChI | InChI=1S/C12H11NO3S/c14-9-1-2-11(15)10(5-9)12(16)13-6-8-3-4-17-7-8/h1-5,7,14-15H,6H2,(H,13,16) |
| InChIKey | VLRKTLGMDKNHBO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|