C12H10INO2S — CID 113222923
2-hydroxy-5-iodo-N-(thiophen-3-ylmethyl)benzamide (PubChem CID 113222923) has the molecular formula C12H10INO2S and a molecular weight of 359.19 g/mol. Its IUPAC name is 2-hydroxy-5-iodo-N-(thiophen-3-ylmethyl)benzamide.
| Compound Name | 2-hydroxy-5-iodo-N-(thiophen-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 113222923 |
| Molecular Formula | C12H10INO2S |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | 2-hydroxy-5-iodo-N-(thiophen-3-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccsc1)c1cc(I)ccc1O |
| InChI | InChI=1S/C12H10INO2S/c13-9-1-2-11(15)10(5-9)12(16)14-6-8-3-4-17-7-8/h1-5,7,15H,6H2,(H,14,16) |
| InChIKey | IYVQZEWBCGMTBF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|