C12H11IN2O4S2 — CID 103600269
2-hydroxy-5-iodo-N-[(5-sulfamoylthiophen-2-yl)methyl]benzamide (PubChem CID 103600269) has the molecular formula C12H11IN2O4S2 and a molecular weight of 438.27 g/mol. Its IUPAC name is 2-hydroxy-5-iodo-N-[(5-sulfamoylthiophen-2-yl)methyl]benzamide.
| Compound Name | 2-hydroxy-5-iodo-N-[(5-sulfamoylthiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 103600269 |
| Molecular Formula | C12H11IN2O4S2 |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 437.92 |
| IUPAC Name | 2-hydroxy-5-iodo-N-[(5-sulfamoylthiophen-2-yl)methyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2cc(I)ccc2O)s1 |
| InChI | InChI=1S/C12H11IN2O4S2/c13-7-1-3-10(16)9(5-7)12(17)15-6-8-2-4-11(20-8)21(14,18)19/h1-5,16H,6H2,(H,15,17)(H2,14,18,19) |
| InChIKey | PGRGRVARBZBECF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|