C10H9ClN2O3S3 — CID 80642639
3-chloro-N-[(5-sulfamoylthiophen-2-yl)methyl]thiophene-2-carboxamide (PubChem CID 80642639) has the molecular formula C10H9ClN2O3S3 and a molecular weight of 336.85 g/mol. Its IUPAC name is 3-chloro-N-[(5-sulfamoylthiophen-2-yl)methyl]thiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(5-sulfamoylthiophen-2-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 80642639 |
| Molecular Formula | C10H9ClN2O3S3 |
| Molecular Weight | 336.85 g/mol |
| Exact Mass | 335.95 |
| IUPAC Name | 3-chloro-N-[(5-sulfamoylthiophen-2-yl)methyl]thiophene-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2sccc2Cl)s1 |
| InChI | InChI=1S/C10H9ClN2O3S3/c11-7-3-4-17-9(7)10(14)13-5-6-1-2-8(18-6)19(12,15)16/h1-4H,5H2,(H,13,14)(H2,12,15,16) |
| InChIKey | BNOJMARTSSPTRS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.85 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |