C14H13N3O3S3 — CID 24658577
3-pyrrol-1-yl-N-[(5-sulfamoylthiophen-2-yl)methyl]thiophene-2-carboxamide (PubChem CID 24658577) has the molecular formula C14H13N3O3S3 and a molecular weight of 367.48 g/mol. Its IUPAC name is 3-pyrrol-1-yl-N-[(5-sulfamoylthiophen-2-yl)methyl]thiophene-2-carboxamide.
| Compound Name | 3-pyrrol-1-yl-N-[(5-sulfamoylthiophen-2-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24658577 |
| Molecular Formula | C14H13N3O3S3 |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 3-pyrrol-1-yl-N-[(5-sulfamoylthiophen-2-yl)methyl]thiophene-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2sccc2-n2cccc2)s1 |
| InChI | InChI=1S/C14H13N3O3S3/c15-23(19,20)12-4-3-10(22-12)9-16-14(18)13-11(5-8-21-13)17-6-1-2-7-17/h1-8H,9H2,(H,16,18)(H2,15,19,20) |
| InChIKey | XOGDHDLQXFEWHL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |