C12H10F2N2O3S2 — CID 62662253
2,3-difluoro-N-[(5-sulfamoylthiophen-2-yl)methyl]benzamide (PubChem CID 62662253) has the molecular formula C12H10F2N2O3S2 and a molecular weight of 332.35 g/mol. Its IUPAC name is 2,3-difluoro-N-[(5-sulfamoylthiophen-2-yl)methyl]benzamide.
| Compound Name | 2,3-difluoro-N-[(5-sulfamoylthiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 62662253 |
| Molecular Formula | C12H10F2N2O3S2 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 2,3-difluoro-N-[(5-sulfamoylthiophen-2-yl)methyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2cccc(F)c2F)s1 |
| InChI | InChI=1S/C12H10F2N2O3S2/c13-9-3-1-2-8(11(9)14)12(17)16-6-7-4-5-10(20-7)21(15,18)19/h1-5H,6H2,(H,16,17)(H2,15,18,19) |
| InChIKey | LCRMQYOOKBRTQN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |