C19H18N2O4S2 — CID 24645763
2-(phenoxymethyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]benzamide (PubChem CID 24645763) has the molecular formula C19H18N2O4S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-(phenoxymethyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]benzamide.
| Compound Name | 2-(phenoxymethyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 24645763 |
| Molecular Formula | C19H18N2O4S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 2-(phenoxymethyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2ccccc2COc2ccccc2)s1 |
| InChI | InChI=1S/C19H18N2O4S2/c20-27(23,24)18-11-10-16(26-18)12-21-19(22)17-9-5-4-6-14(17)13-25-15-7-2-1-3-8-15/h1-11H,12-13H2,(H,21,22)(H2,20,23,24) |
| InChIKey | BEPLLAPMGCXMKE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |