C10H10N4O3S2 — CID 47099016
N-[(5-sulfamoylthiophen-2-yl)methyl]pyrazine-2-carboxamide (PubChem CID 47099016) has the molecular formula C10H10N4O3S2 and a molecular weight of 298.35 g/mol. Its IUPAC name is N-[(5-sulfamoylthiophen-2-yl)methyl]pyrazine-2-carboxamide.
| Compound Name | N-[(5-sulfamoylthiophen-2-yl)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 47099016 |
| Molecular Formula | C10H10N4O3S2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | N-[(5-sulfamoylthiophen-2-yl)methyl]pyrazine-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2cnccn2)s1 |
| InChI | InChI=1S/C10H10N4O3S2/c11-19(16,17)9-2-1-7(18-9)5-14-10(15)8-6-12-3-4-13-8/h1-4,6H,5H2,(H,14,15)(H2,11,16,17) |
| InChIKey | GHZIGZJKXLCQNB-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |