C8H12N2O3S3 — CID 47099009
2-methylsulfanyl-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide (PubChem CID 47099009) has the molecular formula C8H12N2O3S3 and a molecular weight of 280.40 g/mol. Its IUPAC name is 2-methylsulfanyl-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide.
| Compound Name | 2-methylsulfanyl-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 47099009 |
| Molecular Formula | C8H12N2O3S3 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 2-methylsulfanyl-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide |
| SMILES | CSCC(=O)NCc1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C8H12N2O3S3/c1-14-5-7(11)10-4-6-2-3-8(15-6)16(9,12)13/h2-3H,4-5H2,1H3,(H,10,11)(H2,9,12,13) |
| InChIKey | WMJMYGJFDPANGH-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |