C12H15N3O5S4 — CID 18230583
2-[methyl(thiophen-2-ylsulfonyl)amino]-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide (PubChem CID 18230583) has the molecular formula C12H15N3O5S4 and a molecular weight of 409.54 g/mol. Its IUPAC name is 2-[methyl(thiophen-2-ylsulfonyl)amino]-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide.
| Compound Name | 2-[methyl(thiophen-2-ylsulfonyl)amino]-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 18230583 |
| Molecular Formula | C12H15N3O5S4 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | 2-[methyl(thiophen-2-ylsulfonyl)amino]-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide |
| SMILES | CN(CC(=O)NCc1ccc(S(N)(=O)=O)s1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C12H15N3O5S4/c1-15(24(19,20)11-3-2-6-21-11)8-10(16)14-7-9-4-5-12(22-9)23(13,17)18/h2-6H,7-8H2,1H3,(H,14,16)(H2,13,17,18) |
| InChIKey | GRYMOGOFNQLMDD-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |