C9H13N3O4S2 — CID 60668235
2-[[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]amino]acetamide (PubChem CID 60668235) has the molecular formula C9H13N3O4S2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-[[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]amino]acetamide.
| Compound Name | 2-[[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 60668235 |
| Molecular Formula | C9H13N3O4S2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2-[[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]amino]acetamide |
| SMILES | CN(CC(=O)NCC(N)=O)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C9H13N3O4S2/c1-12(6-8(14)11-5-7(10)13)18(15,16)9-3-2-4-17-9/h2-4H,5-6H2,1H3,(H2,10,13)(H,11,14) |
| InChIKey | YDGCKDDYRSSGDX-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |