C11H18N2O4S2 — CID 65109706
N-(2-hydroxy-2-methylpropyl)-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide (PubChem CID 65109706) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-(2-hydroxy-2-methylpropyl)-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide.
| Compound Name | N-(2-hydroxy-2-methylpropyl)-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 65109706 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | N-(2-hydroxy-2-methylpropyl)-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide |
| SMILES | CN(CC(=O)NCC(C)(C)O)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C11H18N2O4S2/c1-11(2,15)8-12-9(14)7-13(3)19(16,17)10-5-4-6-18-10/h4-6,15H,7-8H2,1-3H3,(H,12,14) |
| InChIKey | CHRPAWHRQXXDRZ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |