C11H18N2O3S2 — CID 4190570
N-tert-butyl-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide (PubChem CID 4190570) has the molecular formula C11H18N2O3S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N-tert-butyl-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide.
| Compound Name | N-tert-butyl-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 4190570 |
| Molecular Formula | C11H18N2O3S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N-tert-butyl-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide |
| SMILES | CN(CC(=O)NC(C)(C)C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C11H18N2O3S2/c1-11(2,3)12-9(14)8-13(4)18(15,16)10-6-5-7-17-10/h5-7H,8H2,1-4H3,(H,12,14) |
| InChIKey | SHNLGDPMKPZGIL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |