C17H29N3O3S2 — CID 18165137
N-[[1-(dimethylamino)cycloheptyl]methyl]-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide (PubChem CID 18165137) has the molecular formula C17H29N3O3S2 and a molecular weight of 387.57 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cycloheptyl]methyl]-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide.
| Compound Name | N-[[1-(dimethylamino)cycloheptyl]methyl]-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 18165137 |
| Molecular Formula | C17H29N3O3S2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N-[[1-(dimethylamino)cycloheptyl]methyl]-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide |
| SMILES | CN(C)C1(CNC(=O)CN(C)S(=O)(=O)c2cccs2)CCCCCC1 |
| InChI | InChI=1S/C17H29N3O3S2/c1-19(2)17(10-6-4-5-7-11-17)14-18-15(21)13-20(3)25(22,23)16-9-8-12-24-16/h8-9,12H,4-7,10-11,13-14H2,1-3H3,(H,18,21) |
| InChIKey | NVSNRGJPRVRWKC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |