C11H16N2O3S2 — CID 103706432
2-cyclobutyl-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide (PubChem CID 103706432) has the molecular formula C11H16N2O3S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-cyclobutyl-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide.
| Compound Name | 2-cyclobutyl-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 103706432 |
| Molecular Formula | C11H16N2O3S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-cyclobutyl-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)CC2CCC2)s1 |
| InChI | InChI=1S/C11H16N2O3S2/c12-18(15,16)11-5-4-9(17-11)7-13-10(14)6-8-2-1-3-8/h4-5,8H,1-3,6-7H2,(H,13,14)(H2,12,15,16) |
| InChIKey | KCFYZEIRZUIOEQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |