C15H23N3O3S2 — CID 120984442
9-amino-N-[(5-sulfamoylthiophen-2-yl)methyl]bicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 120984442) has the molecular formula C15H23N3O3S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 9-amino-N-[(5-sulfamoylthiophen-2-yl)methyl]bicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | 9-amino-N-[(5-sulfamoylthiophen-2-yl)methyl]bicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 120984442 |
| Molecular Formula | C15H23N3O3S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 9-amino-N-[(5-sulfamoylthiophen-2-yl)methyl]bicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | NC1C2CCCC1CC(C(=O)NCc1ccc(S(N)(=O)=O)s1)C2 |
| InChI | InChI=1S/C15H23N3O3S2/c16-14-9-2-1-3-10(14)7-11(6-9)15(19)18-8-12-4-5-13(22-12)23(17,20)21/h4-5,9-11,14H,1-3,6-8,16H2,(H,18,19)(H2,17,20,21) |
| InChIKey | LHUHNOJABVSNSO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |