C17H27ClN2OS — CID 120986047
9-amino-N-[(5-ethylthiophen-2-yl)methyl]bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride (PubChem CID 120986047) has the molecular formula C17H27ClN2OS and a molecular weight of 342.94 g/mol. Its IUPAC name is 9-amino-N-[(5-ethylthiophen-2-yl)methyl]bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride.
| Compound Name | 9-amino-N-[(5-ethylthiophen-2-yl)methyl]bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120986047 |
| Molecular Formula | C17H27ClN2OS |
| Molecular Weight | 342.94 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 9-amino-N-[(5-ethylthiophen-2-yl)methyl]bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride |
| SMILES | CCc1ccc(CNC(=O)C2CC3CCCC(C2)C3N)s1.Cl |
| InChI | InChI=1S/C17H26N2OS.ClH/c1-2-14-6-7-15(21-14)10-19-17(20)13-8-11-4-3-5-12(9-13)16(11)18;/h6-7,11-13,16H,2-5,8-10,18H2,1H3,(H,19,20);1H |
| InChIKey | HIIWVSURPGQCIZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.94 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |