C17H24N2O4 — CID 120994216
methyl 5-[[(9-aminobicyclo[3.3.1]nonane-3-carbonyl)amino]methyl]furan-2-carboxylate (PubChem CID 120994216) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is methyl 5-[[(9-aminobicyclo[3.3.1]nonane-3-carbonyl)amino]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(9-aminobicyclo[3.3.1]nonane-3-carbonyl)amino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 120994216 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | methyl 5-[[(9-aminobicyclo[3.3.1]nonane-3-carbonyl)amino]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CNC(=O)C2CC3CCCC(C2)C3N)o1 |
| InChI | InChI=1S/C17H24N2O4/c1-22-17(21)14-6-5-13(23-14)9-19-16(20)12-7-10-3-2-4-11(8-12)15(10)18/h5-6,10-12,15H,2-4,7-9,18H2,1H3,(H,19,20) |
| InChIKey | UQWYCWVNWUPQIA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |