C20H29ClN2O3 — CID 120984703
methyl 4-[2-[(9-aminobicyclo[3.3.1]nonane-3-carbonyl)amino]ethyl]benzoate;hydrochloride (PubChem CID 120984703) has the molecular formula C20H29ClN2O3 and a molecular weight of 380.92 g/mol. Its IUPAC name is methyl 4-[2-[(9-aminobicyclo[3.3.1]nonane-3-carbonyl)amino]ethyl]benzoate;hydrochloride.
| Compound Name | methyl 4-[2-[(9-aminobicyclo[3.3.1]nonane-3-carbonyl)amino]ethyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 120984703 |
| Molecular Formula | C20H29ClN2O3 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | methyl 4-[2-[(9-aminobicyclo[3.3.1]nonane-3-carbonyl)amino]ethyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(CCNC(=O)C2CC3CCCC(C2)C3N)cc1.Cl |
| InChI | InChI=1S/C20H28N2O3.ClH/c1-25-20(24)14-7-5-13(6-8-14)9-10-22-19(23)17-11-15-3-2-4-16(12-17)18(15)21;/h5-8,15-18H,2-4,9-12,21H2,1H3,(H,22,23);1H |
| InChIKey | QPIDPSSEHUXLAU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |