C17H25ClN2O3 — CID 119701390
methyl 4-[2-[(3-aminocyclohexanecarbonyl)amino]ethyl]benzoate;hydrochloride (PubChem CID 119701390) has the molecular formula C17H25ClN2O3 and a molecular weight of 340.85 g/mol. Its IUPAC name is methyl 4-[2-[(3-aminocyclohexanecarbonyl)amino]ethyl]benzoate;hydrochloride.
| Compound Name | methyl 4-[2-[(3-aminocyclohexanecarbonyl)amino]ethyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 119701390 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | methyl 4-[2-[(3-aminocyclohexanecarbonyl)amino]ethyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(CCNC(=O)C2CCCC(N)C2)cc1.Cl |
| InChI | InChI=1S/C17H24N2O3.ClH/c1-22-17(21)13-7-5-12(6-8-13)9-10-19-16(20)14-3-2-4-15(18)11-14;/h5-8,14-15H,2-4,9-11,18H2,1H3,(H,19,20);1H |
| InChIKey | GUYMTFKPHXMGGJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |